C27H36O8 — CID 68724153
(Z)-3-[3-butoxy-4-[2-[4-(2-methoxyethoxymethoxy)phenyl]ethoxy]phenyl]-2-ethoxyprop-2-enoic acid (PubChem CID 68724153) has the molecular formula C27H36O8 and a molecular weight of 488.58 g/mol. Its IUPAC name is (Z)-3-[3-butoxy-4-[2-[4-(2-methoxyethoxymethoxy)phenyl]ethoxy]phenyl]-2-ethoxyprop-2-enoic acid.
| Compound Name | (Z)-3-[3-butoxy-4-[2-[4-(2-methoxyethoxymethoxy)phenyl]ethoxy]phenyl]-2-ethoxyprop-2-enoic acid |
|---|---|
| PubChem CID | 68724153 |
| Molecular Formula | C27H36O8 |
| Molecular Weight | 488.58 g/mol |
| Exact Mass | 488.24 |
| IUPAC Name | (Z)-3-[3-butoxy-4-[2-[4-(2-methoxyethoxymethoxy)phenyl]ethoxy]phenyl]-2-ethoxyprop-2-enoic acid |
| SMILES | CCCCOc1cc(/C=C(\OCC)C(=O)O)ccc1OCCc1ccc(OCOCCOC)cc1 |
| InChI | InChI=1S/C27H36O8/c1-4-6-14-33-25-18-22(19-26(27(28)29)32-5-2)9-12-24(25)34-15-13-21-7-10-23(11-8-21)35-20-31-17-16-30-3/h7-12,18-19H,4-6,13-17,20H2,1-3H3,(H,28,29)/b26-19- |
| InChIKey | KAAHKUGPZYKINY-XHPQRKPJSA-N |
| XLogP | 4.95 |
| TPSA | 92.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.58 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|