C28H38O9S — CID 173096341
3-[3-butoxy-4-[2-(2-butylsulfonyloxy-3-methoxyphenyl)ethoxy]phenyl]-2-ethoxyprop-2-enoic acid (PubChem CID 173096341) has the molecular formula C28H38O9S and a molecular weight of 550.67 g/mol. Its IUPAC name is 3-[3-butoxy-4-[2-(2-butylsulfonyloxy-3-methoxyphenyl)ethoxy]phenyl]-2-ethoxyprop-2-enoic acid.
| Compound Name | 3-[3-butoxy-4-[2-(2-butylsulfonyloxy-3-methoxyphenyl)ethoxy]phenyl]-2-ethoxyprop-2-enoic acid |
|---|---|
| PubChem CID | 173096341 |
| Molecular Formula | C28H38O9S |
| Molecular Weight | 550.67 g/mol |
| Exact Mass | 550.22 |
| IUPAC Name | 3-[3-butoxy-4-[2-(2-butylsulfonyloxy-3-methoxyphenyl)ethoxy]phenyl]-2-ethoxyprop-2-enoic acid |
| SMILES | CCCCOc1cc(C=C(OCC)C(=O)O)ccc1OCCc1cccc(OC)c1OS(=O)(=O)CCCC |
| InChI | InChI=1S/C28H38O9S/c1-5-8-16-35-25-19-21(20-26(28(29)30)34-7-3)13-14-23(25)36-17-15-22-11-10-12-24(33-4)27(22)37-38(31,32)18-9-6-2/h10-14,19-20H,5-9,15-18H2,1-4H3,(H,29,30) |
| InChIKey | DZJIZHRMODHWBB-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 117.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.67 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|