C21H25Cl2OTi- — CID 140556294
dichlorotitanium;2,6-di(propan-2-yl)phenol;1H-inden-1-ide (PubChem CID 140556294) has the molecular formula C21H25Cl2OTi- and a molecular weight of 412.20 g/mol. Its IUPAC name is dichlorotitanium;2,6-di(propan-2-yl)phenol;1H-inden-1-ide.
| Compound Name | dichlorotitanium;2,6-di(propan-2-yl)phenol;1H-inden-1-ide |
|---|---|
| PubChem CID | 140556294 |
| Molecular Formula | C21H25Cl2OTi- |
| Molecular Weight | 412.20 g/mol |
| Exact Mass | 411.08 |
| IUPAC Name | dichlorotitanium;2,6-di(propan-2-yl)phenol;1H-inden-1-ide |
| SMILES | CC(C)c1cccc(C(C)C)c1O.Cl[Ti]Cl.c1ccc2[cH-]ccc2c1 |
| InChI | InChI=1S/C12H18O.C9H7.2ClH.Ti/c1-8(2)10-6-5-7-11(9(3)4)12(10)13;1-2-5-9-7-3-6-8(9)4-1;;;/h5-9,13H,1-4H3;1-7H;2*1H;/q;-1;;;+2/p-2 |
| InChIKey | XNITYZUOTSCDAF-UHFFFAOYSA-L |
| XLogP | 7.57 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.20 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|