C18H26Zr — CID 140557001
1-butyl-2-methylcyclopenta-1,3-diene;cyclopenta-1,3-diene;propan-2-ylidenezirconium(2+) (PubChem CID 140557001) has the molecular formula C18H26Zr and a molecular weight of 333.63 g/mol. Its IUPAC name is 1-butyl-2-methylcyclopenta-1,3-diene;cyclopenta-1,3-diene;propan-2-ylidenezirconium(2+).
| Compound Name | 1-butyl-2-methylcyclopenta-1,3-diene;cyclopenta-1,3-diene;propan-2-ylidenezirconium(2+) |
|---|---|
| PubChem CID | 140557001 |
| Molecular Formula | C18H26Zr |
| Molecular Weight | 333.63 g/mol |
| Exact Mass | 332.11 |
| IUPAC Name | 1-butyl-2-methylcyclopenta-1,3-diene;cyclopenta-1,3-diene;propan-2-ylidenezirconium(2+) |
| SMILES | CC(C)=[Zr+2].CCCCC1=C(C)C=[C-]C1.[C-]1=CC=CC1 |
| InChI | InChI=1S/C10H15.C5H5.C3H6.Zr/c1-3-4-7-10-8-5-6-9(10)2;1-2-4-5-3-1;1-3-2;/h6H,3-4,7-8H2,1-2H3;1-3H,4H2;1-2H3;/q2*-1;;+2 |
| InChIKey | PEXJFFUHZQXQMI-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.63 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|