C15H20Hf-2 — CID 173380449
2-butyl-5-methylcyclopenta-1,3-diene;cyclopenta-1,3-diene;hafnium (PubChem CID 173380449) has the molecular formula C15H20Hf-2 and a molecular weight of 378.82 g/mol. Its IUPAC name is 2-butyl-5-methylcyclopenta-1,3-diene;cyclopenta-1,3-diene;hafnium.
| Compound Name | 2-butyl-5-methylcyclopenta-1,3-diene;cyclopenta-1,3-diene;hafnium |
|---|---|
| PubChem CID | 173380449 |
| Molecular Formula | C15H20Hf-2 |
| Molecular Weight | 378.82 g/mol |
| Exact Mass | 380.10 |
| IUPAC Name | 2-butyl-5-methylcyclopenta-1,3-diene;cyclopenta-1,3-diene;hafnium |
| SMILES | CCCCc1cc[c-](C)c1.[C-]1=CC=CC1.[Hf] |
| InChI | InChI=1S/C10H15.C5H5.Hf/c1-3-4-5-10-7-6-9(2)8-10;1-2-4-5-3-1;/h6-8H,3-5H2,1-2H3;1-3H,4H2;/q2*-1; |
| InChIKey | NKKMXKDVTGSVNS-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.82 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|