C16H24SiZr — CID 173079976
2-butylcyclopenta-1,3-diene;cyclopenta-1,3-diene;dimethylsilylidenezirconium(2+) (PubChem CID 173079976) has the molecular formula C16H24SiZr and a molecular weight of 335.68 g/mol. Its IUPAC name is 2-butylcyclopenta-1,3-diene;cyclopenta-1,3-diene;dimethylsilylidenezirconium(2+).
| Compound Name | 2-butylcyclopenta-1,3-diene;cyclopenta-1,3-diene;dimethylsilylidenezirconium(2+) |
|---|---|
| PubChem CID | 173079976 |
| Molecular Formula | C16H24SiZr |
| Molecular Weight | 335.68 g/mol |
| Exact Mass | 334.07 |
| IUPAC Name | 2-butylcyclopenta-1,3-diene;cyclopenta-1,3-diene;dimethylsilylidenezirconium(2+) |
| SMILES | CCCCC1=CC[C-]=C1.C[Si](C)=[Zr+2].[C-]1=CC=CC1 |
| InChI | InChI=1S/C9H13.C5H5.C2H6Si.Zr/c1-2-3-6-9-7-4-5-8-9;1-2-4-5-3-1;1-3-2;/h7-8H,2-4,6H2,1H3;1-3H,4H2;1-2H3;/q2*-1;;+2 |
| InChIKey | CEFIRVDYXNYTKA-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.68 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|