About cyclopenta-1,3-diene;dimethylsilylidenezirconium(2+);2-propylcyclopenta-1,3-diene
cyclopenta-1,3-diene;dimethylsilylidenezirconium(2+);2-propylcyclopenta-1,3-diene (PubChem CID 173079907) has the molecular formula C15H22SiZr
and a molecular weight of 321.65 g/mol. Its IUPAC name is cyclopenta-1,3-diene;dimethylsilylidenezirconium(2+);2-propylcyclopenta-1,3-diene.
Molecular Properties
| Compound Name | cyclopenta-1,3-diene;dimethylsilylidenezirconium(2+);2-propylcyclopenta-1,3-diene |
| PubChem CID | 173079907 |
| Molecular Formula | C15H22SiZr |
| Molecular Weight | 321.65 g/mol |
| Exact Mass | 320.05 |
| IUPAC Name | cyclopenta-1,3-diene;dimethylsilylidenezirconium(2+);2-propylcyclopenta-1,3-diene |
| SMILES | CCCC1=CC[C-]=C1.C[Si](C)=[Zr+2].[C-]1=CC=CC1 |
| InChI | InChI=1S/C8H11.C5H5.C2H6Si.Zr/c1-2-5-8-6-3-4-7-8;1-2-4-5-3-1;1-3-2;/h6-7H,2-3,5H2,1H3;1-3H,4H2;1-2H3;/q2*-1;;+2 |
| InChIKey | FDXKINXYXLEGBD-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.65 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze cyclopenta-1,3-diene;dimethylsilylidenezirconium(2+);2-propylcyclopenta-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopenta-1,3-diene;dimethylsilylidenezirconium(2+);2-propylcyclopenta-1,3-diene?
The IUPAC name of cyclopenta-1,3-diene;dimethylsilylidenezirconium(2+);2-propylcyclopenta-1,3-diene (CID 173079907) is cyclopenta-1,3-diene;dimethylsilylidenezirconium(2+);2-propylcyclopenta-1,3-diene.
What is the SMILES notation for cyclopenta-1,3-diene;dimethylsilylidenezirconium(2+);2-propylcyclopenta-1,3-diene?
The canonical SMILES for cyclopenta-1,3-diene;dimethylsilylidenezirconium(2+);2-propylcyclopenta-1,3-diene is CCCC1=CC[C-]=C1.C[Si](C)=[Zr+2].[C-]1=CC=CC1.
What is the InChIKey of cyclopenta-1,3-diene;dimethylsilylidenezirconium(2+);2-propylcyclopenta-1,3-diene?
The InChIKey is FDXKINXYXLEGBD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11.C5H5.C2H6Si.Zr/c1-2-5-8-6-3-4-7-8;1-2-4-5-3-1;1-3-2;/h6-7H,2-3,5H2,1H3;1-3H,4H2;1-2H3;/q2*-1;;+2.
What are the key properties of cyclopenta-1,3-diene;dimethylsilylidenezirconium(2+);2-propylcyclopenta-1,3-diene?
cyclopenta-1,3-diene;dimethylsilylidenezirconium(2+);2-propylcyclopenta-1,3-diene has a molecular weight of 321.65 g/mol, XLogP of 4.57, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopenta-1,3-diene;dimethylsilylidenezirconium(2+);2-propylcyclopenta-1,3-diene is sourced from PubChem (CID 173079907), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).