C15H22SiZr — CID 173079907
cyclopenta-1,3-diene;dimethylsilylidenezirconium(2+);2-propylcyclopenta-1,3-diene (PubChem CID 173079907) has the molecular formula C15H22SiZr and a molecular weight of 321.65 g/mol. Its IUPAC name is cyclopenta-1,3-diene;dimethylsilylidenezirconium(2+);2-propylcyclopenta-1,3-diene.
| Compound Name | cyclopenta-1,3-diene;dimethylsilylidenezirconium(2+);2-propylcyclopenta-1,3-diene |
|---|---|
| PubChem CID | 173079907 |
| Molecular Formula | C15H22SiZr |
| Molecular Weight | 321.65 g/mol |
| Exact Mass | 320.05 |
| IUPAC Name | cyclopenta-1,3-diene;dimethylsilylidenezirconium(2+);2-propylcyclopenta-1,3-diene |
| SMILES | CCCC1=CC[C-]=C1.C[Si](C)=[Zr+2].[C-]1=CC=CC1 |
| InChI | InChI=1S/C8H11.C5H5.C2H6Si.Zr/c1-2-5-8-6-3-4-7-8;1-2-4-5-3-1;1-3-2;/h6-7H,2-3,5H2,1H3;1-3H,4H2;1-2H3;/q2*-1;;+2 |
| InChIKey | FDXKINXYXLEGBD-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.65 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|