C11H21CuP+ — CID 87461476
copper(1+);cyclopenta-1,3-diene;triethylphosphanium (PubChem CID 87461476) has the molecular formula C11H21CuP+ and a molecular weight of 247.81 g/mol. Its IUPAC name is copper(1+);cyclopenta-1,3-diene;triethylphosphanium.
| Compound Name | copper(1+);cyclopenta-1,3-diene;triethylphosphanium |
|---|---|
| PubChem CID | 87461476 |
| Molecular Formula | C11H21CuP+ |
| Molecular Weight | 247.81 g/mol |
| Exact Mass | 247.07 |
| IUPAC Name | copper(1+);cyclopenta-1,3-diene;triethylphosphanium |
| SMILES | CC[PH+](CC)CC.[C-]1=CC=CC1.[Cu+] |
| InChI | InChI=1S/C6H15P.C5H5.Cu/c1-4-7(5-2)6-3;1-2-4-5-3-1;/h4-6H2,1-3H3;1-3H,4H2;/q;-1;+1/p+1 |
| InChIKey | CAQRCHPYGOUCRP-UHFFFAOYSA-O |
| XLogP | 3.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.81 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|