About 2-[3,5-difluoro-4-(methanesulfonamido)phenyl]propanamide
2-[3,5-difluoro-4-(methanesulfonamido)phenyl]propanamide (PubChem CID 140559120) has the molecular formula C10H12F2N2O3S
and a molecular weight of 278.28 g/mol. Its IUPAC name is 2-[3,5-difluoro-4-(methanesulfonamido)phenyl]propanamide.
Molecular Properties
| Compound Name | 2-[3,5-difluoro-4-(methanesulfonamido)phenyl]propanamide |
| PubChem CID | 140559120 |
| Molecular Formula | C10H12F2N2O3S |
| Molecular Weight | 278.28 g/mol |
| Exact Mass | 278.05 |
| IUPAC Name | 2-[3,5-difluoro-4-(methanesulfonamido)phenyl]propanamide |
| SMILES | CC(C(N)=O)c1cc(F)c(NS(C)(=O)=O)c(F)c1 |
| InChI | InChI=1S/C10H12F2N2O3S/c1-5(10(13)15)6-3-7(11)9(8(12)4-6)14-18(2,16)17/h3-5,14H,1-2H3,(H2,13,15) |
| InChIKey | ZCJCVCLEZNXMGK-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.28 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[3,5-difluoro-4-(methanesulfonamido)phenyl]propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3,5-difluoro-4-(methanesulfonamido)phenyl]propanamide?
The IUPAC name of 2-[3,5-difluoro-4-(methanesulfonamido)phenyl]propanamide (CID 140559120) is 2-[3,5-difluoro-4-(methanesulfonamido)phenyl]propanamide.
What is the SMILES notation for 2-[3,5-difluoro-4-(methanesulfonamido)phenyl]propanamide?
The canonical SMILES for 2-[3,5-difluoro-4-(methanesulfonamido)phenyl]propanamide is CC(C(N)=O)c1cc(F)c(NS(C)(=O)=O)c(F)c1.
What is the InChIKey of 2-[3,5-difluoro-4-(methanesulfonamido)phenyl]propanamide?
The InChIKey is ZCJCVCLEZNXMGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12F2N2O3S/c1-5(10(13)15)6-3-7(11)9(8(12)4-6)14-18(2,16)17/h3-5,14H,1-2H3,(H2,13,15).
What are the key properties of 2-[3,5-difluoro-4-(methanesulfonamido)phenyl]propanamide?
2-[3,5-difluoro-4-(methanesulfonamido)phenyl]propanamide has a molecular weight of 278.28 g/mol, XLogP of 0.93, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3,5-difluoro-4-(methanesulfonamido)phenyl]propanamide is sourced from PubChem (CID 140559120), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).