C9H11FN2O3S — CID 91006628
3-fluoro-4-(methanesulfonamido)-5-methylbenzamide (PubChem CID 91006628) has the molecular formula C9H11FN2O3S and a molecular weight of 246.26 g/mol. Its IUPAC name is 3-fluoro-4-(methanesulfonamido)-5-methylbenzamide.
| Compound Name | 3-fluoro-4-(methanesulfonamido)-5-methylbenzamide |
|---|---|
| PubChem CID | 91006628 |
| Molecular Formula | C9H11FN2O3S |
| Molecular Weight | 246.26 g/mol |
| Exact Mass | 246.05 |
| IUPAC Name | 3-fluoro-4-(methanesulfonamido)-5-methylbenzamide |
| SMILES | Cc1cc(C(N)=O)cc(F)c1NS(C)(=O)=O |
| InChI | InChI=1S/C9H11FN2O3S/c1-5-3-6(9(11)13)4-7(10)8(5)12-16(2,14)15/h3-4,12H,1-2H3,(H2,11,13) |
| InChIKey | WTJUIQWTDFZWGF-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.26 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |