C14H13N3O10 — CID 140564026
1-[[2,4,6-trioxo-3,5-di(prop-2-enoyloxy)-1,3,5-triazinan-1-yl]oxy]ethyl prop-2-enoate (PubChem CID 140564026) has the molecular formula C14H13N3O10 and a molecular weight of 383.27 g/mol. Its IUPAC name is 1-[[2,4,6-trioxo-3,5-di(prop-2-enoyloxy)-1,3,5-triazinan-1-yl]oxy]ethyl prop-2-enoate.
| Compound Name | 1-[[2,4,6-trioxo-3,5-di(prop-2-enoyloxy)-1,3,5-triazinan-1-yl]oxy]ethyl prop-2-enoate |
|---|---|
| PubChem CID | 140564026 |
| Molecular Formula | C14H13N3O10 |
| Molecular Weight | 383.27 g/mol |
| Exact Mass | 383.06 |
| IUPAC Name | 1-[[2,4,6-trioxo-3,5-di(prop-2-enoyloxy)-1,3,5-triazinan-1-yl]oxy]ethyl prop-2-enoate |
| SMILES | C=CC(=O)OC(C)On1c(=O)n(OC(=O)C=C)c(=O)n(OC(=O)C=C)c1=O |
| InChI | InChI=1S/C14H13N3O10/c1-5-9(18)24-8(4)25-15-12(21)16(26-10(19)6-2)14(23)17(13(15)22)27-11(20)7-3/h5-8H,1-3H2,4H3 |
| InChIKey | VEHLGWKRBYUHEY-UHFFFAOYSA-N |
| XLogP | -3.04 |
| TPSA | 154.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.27 |
| LogP ≤ 5 | -3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|