About [2-methyl-1-[(2-methyl-1-prop-2-enoyloxypropyl)amino]propyl] prop-2-enoate;phosphoric acid
[2-methyl-1-[(2-methyl-1-prop-2-enoyloxypropyl)amino]propyl] prop-2-enoate;phosphoric acid (PubChem CID 174919478) has the molecular formula C14H26NO8P
and a molecular weight of 367.34 g/mol. Its IUPAC name is [2-methyl-1-[(2-methyl-1-prop-2-enoyloxypropyl)amino]propyl] prop-2-enoate;phosphoric acid.
Molecular Properties
| Compound Name | [2-methyl-1-[(2-methyl-1-prop-2-enoyloxypropyl)amino]propyl] prop-2-enoate;phosphoric acid |
| PubChem CID | 174919478 |
| Molecular Formula | C14H26NO8P |
| Molecular Weight | 367.34 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | [2-methyl-1-[(2-methyl-1-prop-2-enoyloxypropyl)amino]propyl] prop-2-enoate;phosphoric acid |
| SMILES | C=CC(=O)OC(NC(OC(=O)C=C)C(C)C)C(C)C.O=P(O)(O)O |
| InChI | InChI=1S/C14H23NO4.H3O4P/c1-7-11(16)18-13(9(3)4)15-14(10(5)6)19-12(17)8-2;1-5(2,3)4/h7-10,13-15H,1-2H2,3-6H3;(H3,1,2,3,4) |
| InChIKey | PPAFPKXTLXPBSY-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 142.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.34 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [2-methyl-1-[(2-methyl-1-prop-2-enoyloxypropyl)amino]propyl] prop-2-enoate;phosphoric acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-methyl-1-[(2-methyl-1-prop-2-enoyloxypropyl)amino]propyl] prop-2-enoate;phosphoric acid?
The IUPAC name of [2-methyl-1-[(2-methyl-1-prop-2-enoyloxypropyl)amino]propyl] prop-2-enoate;phosphoric acid (CID 174919478) is [2-methyl-1-[(2-methyl-1-prop-2-enoyloxypropyl)amino]propyl] prop-2-enoate;phosphoric acid.
What is the SMILES notation for [2-methyl-1-[(2-methyl-1-prop-2-enoyloxypropyl)amino]propyl] prop-2-enoate;phosphoric acid?
The canonical SMILES for [2-methyl-1-[(2-methyl-1-prop-2-enoyloxypropyl)amino]propyl] prop-2-enoate;phosphoric acid is C=CC(=O)OC(NC(OC(=O)C=C)C(C)C)C(C)C.O=P(O)(O)O.
What is the InChIKey of [2-methyl-1-[(2-methyl-1-prop-2-enoyloxypropyl)amino]propyl] prop-2-enoate;phosphoric acid?
The InChIKey is PPAFPKXTLXPBSY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H23NO4.H3O4P/c1-7-11(16)18-13(9(3)4)15-14(10(5)6)19-12(17)8-2;1-5(2,3)4/h7-10,13-15H,1-2H2,3-6H3;(H3,1,2,3,4).
What are the key properties of [2-methyl-1-[(2-methyl-1-prop-2-enoyloxypropyl)amino]propyl] prop-2-enoate;phosphoric acid?
[2-methyl-1-[(2-methyl-1-prop-2-enoyloxypropyl)amino]propyl] prop-2-enoate;phosphoric acid has a molecular weight of 367.34 g/mol, XLogP of 1.07, 8 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-methyl-1-[(2-methyl-1-prop-2-enoyloxypropyl)amino]propyl] prop-2-enoate;phosphoric acid is sourced from PubChem (CID 174919478), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).