C25H22N2O4 — CID 140565579
methyl 3-[2-hydroxy-3-pyridin-4-yl-4-(quinolin-2-ylmethoxy)phenyl]propanoate (PubChem CID 140565579) has the molecular formula C25H22N2O4 and a molecular weight of 414.46 g/mol. Its IUPAC name is methyl 3-[2-hydroxy-3-pyridin-4-yl-4-(quinolin-2-ylmethoxy)phenyl]propanoate.
| Compound Name | methyl 3-[2-hydroxy-3-pyridin-4-yl-4-(quinolin-2-ylmethoxy)phenyl]propanoate |
|---|---|
| PubChem CID | 140565579 |
| Molecular Formula | C25H22N2O4 |
| Molecular Weight | 414.46 g/mol |
| Exact Mass | 414.16 |
| IUPAC Name | methyl 3-[2-hydroxy-3-pyridin-4-yl-4-(quinolin-2-ylmethoxy)phenyl]propanoate |
| SMILES | COC(=O)CCc1ccc(OCc2ccc3ccccc3n2)c(-c2ccncc2)c1O |
| InChI | InChI=1S/C25H22N2O4/c1-30-23(28)11-8-19-7-10-22(24(25(19)29)18-12-14-26-15-13-18)31-16-20-9-6-17-4-2-3-5-21(17)27-20/h2-7,9-10,12-15,29H,8,11,16H2,1H3 |
| InChIKey | RNJYKJVDZXAWFP-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 81.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.46 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |