C9H15N3O — CID 140567735
N-(2-aminoethyl)-1,4-dimethylpyrrole-2-carboxamide (PubChem CID 140567735) has the molecular formula C9H15N3O and a molecular weight of 181.24 g/mol. Its IUPAC name is N-(2-aminoethyl)-1,4-dimethylpyrrole-2-carboxamide.
| Compound Name | N-(2-aminoethyl)-1,4-dimethylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 140567735 |
| Molecular Formula | C9H15N3O |
| Molecular Weight | 181.24 g/mol |
| Exact Mass | 181.12 |
| IUPAC Name | N-(2-aminoethyl)-1,4-dimethylpyrrole-2-carboxamide |
| SMILES | Cc1cc(C(=O)NCCN)n(C)c1 |
| InChI | InChI=1S/C9H15N3O/c1-7-5-8(12(2)6-7)9(13)11-4-3-10/h5-6H,3-4,10H2,1-2H3,(H,11,13) |
| InChIKey | BZNBRKANUZENAD-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 60.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.24 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |