C10H16N2O2 — CID 59268176
N-(2-methoxyethyl)-1,4-dimethylpyrrole-2-carboxamide (PubChem CID 59268176) has the molecular formula C10H16N2O2 and a molecular weight of 196.25 g/mol. Its IUPAC name is N-(2-methoxyethyl)-1,4-dimethylpyrrole-2-carboxamide.
| Compound Name | N-(2-methoxyethyl)-1,4-dimethylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 59268176 |
| Molecular Formula | C10H16N2O2 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.12 |
| IUPAC Name | N-(2-methoxyethyl)-1,4-dimethylpyrrole-2-carboxamide |
| SMILES | COCCNC(=O)c1cc(C)cn1C |
| InChI | InChI=1S/C10H16N2O2/c1-8-6-9(12(2)7-8)10(13)11-4-5-14-3/h6-7H,4-5H2,1-3H3,(H,11,13) |
| InChIKey | DCTIEIGAOCYTLI-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 43.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|