C9H13BI2N2OV — CID 158010749
CID 158010749 (PubChem CID 158010749) has the molecular formula C9H13BI2N2OV and a molecular weight of 480.78 g/mol.
| Compound Name | CID 158010749 |
|---|---|
| PubChem CID | 158010749 |
| Molecular Formula | C9H13BI2N2OV |
| Molecular Weight | 480.78 g/mol |
| Exact Mass | 480.86 |
| IUPAC Name | — |
| SMILES | I[V]I.[B]CCNC(=O)c1cc(C)cn1C |
| InChI | InChI=1S/C9H13BN2O.2HI.V/c1-7-5-8(12(2)6-7)9(13)11-4-3-10;;;/h5-6H,3-4H2,1-2H3,(H,11,13);2*1H;/q;;;+2/p-2 |
| InChIKey | RDMXXDIDHIYMPM-UHFFFAOYSA-L |
| XLogP | 2.42 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.78 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|