About (2R)-2,6-diamino-3-azidohexanoic acid
(2R)-2,6-diamino-3-azidohexanoic acid (PubChem CID 140570098) has the molecular formula C6H13N5O2
and a molecular weight of 187.20 g/mol. Its IUPAC name is (2R)-2,6-diamino-3-azidohexanoic acid.
Molecular Properties
| Compound Name | (2R)-2,6-diamino-3-azidohexanoic acid |
| PubChem CID | 140570098 |
| Molecular Formula | C6H13N5O2 |
| Molecular Weight | 187.20 g/mol |
| Exact Mass | 187.11 |
| IUPAC Name | (2R)-2,6-diamino-3-azidohexanoic acid |
| SMILES | [N-]=[N+]=NC(CCCN)[C@@H](N)C(=O)O |
| InChI | InChI=1S/C6H13N5O2/c7-3-1-2-4(10-11-9)5(8)6(12)13/h4-5H,1-3,7-8H2,(H,12,13)/t4?,5-/m1/s1 |
| InChIKey | HHKSZWQLTOVVTI-BRJRFNKRSA-N |
| XLogP | -0.18 |
| TPSA | 138.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.20 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze (2R)-2,6-diamino-3-azidohexanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2,6-diamino-3-azidohexanoic acid?
The IUPAC name of (2R)-2,6-diamino-3-azidohexanoic acid (CID 140570098) is (2R)-2,6-diamino-3-azidohexanoic acid.
What is the SMILES notation for (2R)-2,6-diamino-3-azidohexanoic acid?
The canonical SMILES for (2R)-2,6-diamino-3-azidohexanoic acid is [N-]=[N+]=NC(CCCN)[C@@H](N)C(=O)O.
What is the InChIKey of (2R)-2,6-diamino-3-azidohexanoic acid?
The InChIKey is HHKSZWQLTOVVTI-BRJRFNKRSA-N. The full InChI is InChI=1S/C6H13N5O2/c7-3-1-2-4(10-11-9)5(8)6(12)13/h4-5H,1-3,7-8H2,(H,12,13)/t4?,5-/m1/s1.
What are the key properties of (2R)-2,6-diamino-3-azidohexanoic acid?
(2R)-2,6-diamino-3-azidohexanoic acid has a molecular weight of 187.20 g/mol, XLogP of -0.18, 6 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2,6-diamino-3-azidohexanoic acid is sourced from PubChem (CID 140570098), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).