C28H32ClN3O4 — CID 140570431
8-chloro-9-[[(E)-3-cyclohexyl-1-pyridin-3-ylprop-2-enyl]amino]spiro[1,2,3,4-tetrahydro-3-benzazepine-5,2'-1,3-dioxepane]-4',7'-dione (PubChem CID 140570431) has the molecular formula C28H32ClN3O4 and a molecular weight of 510.03 g/mol. Its IUPAC name is 8-chloro-9-[[(E)-3-cyclohexyl-1-pyridin-3-ylprop-2-enyl]amino]spiro[1,2,3,4-tetrahydro-3-benzazepine-5,2'-1,3-dioxepane]-4',7'-dione.
| Compound Name | 8-chloro-9-[[(E)-3-cyclohexyl-1-pyridin-3-ylprop-2-enyl]amino]spiro[1,2,3,4-tetrahydro-3-benzazepine-5,2'-1,3-dioxepane]-4',7'-dione |
|---|---|
| PubChem CID | 140570431 |
| Molecular Formula | C28H32ClN3O4 |
| Molecular Weight | 510.03 g/mol |
| Exact Mass | 509.21 |
| IUPAC Name | 8-chloro-9-[[(E)-3-cyclohexyl-1-pyridin-3-ylprop-2-enyl]amino]spiro[1,2,3,4-tetrahydro-3-benzazepine-5,2'-1,3-dioxepane]-4',7'-dione |
| SMILES | O=C1CCC(=O)OC2(CNCCc3c2ccc(Cl)c3NC(/C=C/C2CCCCC2)c2cccnc2)O1 |
| InChI | InChI=1S/C28H32ClN3O4/c29-23-10-9-22-21(14-16-31-18-28(22)35-25(33)12-13-26(34)36-28)27(23)32-24(20-7-4-15-30-17-20)11-8-19-5-2-1-3-6-19/h4,7-11,15,17,19,24,31-32H,1-3,5-6,12-14,16,18H2/b11-8+ |
| InChIKey | VYFVGDCCCDQFET-DHZHZOJOSA-N |
| XLogP | 5.20 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.03 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|