C20H23ClN6O3S2 — CID 140570531
N-[2-chloro-4-(2-cyanopyrrol-1-yl)-1-(4-methylpiperidin-1-yl)-1-oxobutan-2-yl]imidazo[2,1-b][1,3]thiazole-5-sulfonamide (PubChem CID 140570531) has the molecular formula C20H23ClN6O3S2 and a molecular weight of 495.03 g/mol. Its IUPAC name is N-[2-chloro-4-(2-cyanopyrrol-1-yl)-1-(4-methylpiperidin-1-yl)-1-oxobutan-2-yl]imidazo[2,1-b][1,3]thiazole-5-sulfonamide.
| Compound Name | N-[2-chloro-4-(2-cyanopyrrol-1-yl)-1-(4-methylpiperidin-1-yl)-1-oxobutan-2-yl]imidazo[2,1-b][1,3]thiazole-5-sulfonamide |
|---|---|
| PubChem CID | 140570531 |
| Molecular Formula | C20H23ClN6O3S2 |
| Molecular Weight | 495.03 g/mol |
| Exact Mass | 494.10 |
| IUPAC Name | N-[2-chloro-4-(2-cyanopyrrol-1-yl)-1-(4-methylpiperidin-1-yl)-1-oxobutan-2-yl]imidazo[2,1-b][1,3]thiazole-5-sulfonamide |
| SMILES | CC1CCN(C(=O)C(Cl)(CCn2cccc2C#N)NS(=O)(=O)c2cnc3sccn23)CC1 |
| InChI | InChI=1S/C20H23ClN6O3S2/c1-15-4-8-26(9-5-15)18(28)20(21,6-10-25-7-2-3-16(25)13-22)24-32(29,30)17-14-23-19-27(17)11-12-31-19/h2-3,7,11-12,14-15,24H,4-6,8-10H2,1H3 |
| InChIKey | XDIAZVPJCRCQEB-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 112.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.03 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|