C20H25ClN6O3S2 — CID 89143059
6-chloro-N-[4-(2-cyanopyrrol-1-yl)-1-(4-methylpiperidin-1-yl)-1-oxobutan-2-yl]-5,6-dihydroimidazo[2,1-b][1,3]thiazole-5-sulfonamide (PubChem CID 89143059) has the molecular formula C20H25ClN6O3S2 and a molecular weight of 497.05 g/mol. Its IUPAC name is 6-chloro-N-[4-(2-cyanopyrrol-1-yl)-1-(4-methylpiperidin-1-yl)-1-oxobutan-2-yl]-5,6-dihydroimidazo[2,1-b][1,3]thiazole-5-sulfonamide.
| Compound Name | 6-chloro-N-[4-(2-cyanopyrrol-1-yl)-1-(4-methylpiperidin-1-yl)-1-oxobutan-2-yl]-5,6-dihydroimidazo[2,1-b][1,3]thiazole-5-sulfonamide |
|---|---|
| PubChem CID | 89143059 |
| Molecular Formula | C20H25ClN6O3S2 |
| Molecular Weight | 497.05 g/mol |
| Exact Mass | 496.11 |
| IUPAC Name | 6-chloro-N-[4-(2-cyanopyrrol-1-yl)-1-(4-methylpiperidin-1-yl)-1-oxobutan-2-yl]-5,6-dihydroimidazo[2,1-b][1,3]thiazole-5-sulfonamide |
| SMILES | CC1CCN(C(=O)C(CCn2cccc2C#N)NS(=O)(=O)C2C(Cl)N=C3SC=CN32)CC1 |
| InChI | InChI=1S/C20H25ClN6O3S2/c1-14-4-8-26(9-5-14)18(28)16(6-10-25-7-2-3-15(25)13-22)24-32(29,30)19-17(21)23-20-27(19)11-12-31-20/h2-3,7,11-12,14,16-17,19,24H,4-6,8-10H2,1H3 |
| InChIKey | QQYQXNCPERIIQA-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.05 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|