C32H53NO2 — CID 140571106
[4-[2-[4-[bis(4-methylcyclohexyl)amino]cyclohexyl]ethenyl]cyclohexyl] 2-methylprop-2-enoate (PubChem CID 140571106) has the molecular formula C32H53NO2 and a molecular weight of 483.78 g/mol. Its IUPAC name is [4-[2-[4-[bis(4-methylcyclohexyl)amino]cyclohexyl]ethenyl]cyclohexyl] 2-methylprop-2-enoate.
| Compound Name | [4-[2-[4-[bis(4-methylcyclohexyl)amino]cyclohexyl]ethenyl]cyclohexyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 140571106 |
| Molecular Formula | C32H53NO2 |
| Molecular Weight | 483.78 g/mol |
| Exact Mass | 483.41 |
| IUPAC Name | [4-[2-[4-[bis(4-methylcyclohexyl)amino]cyclohexyl]ethenyl]cyclohexyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC1CCC(C=CC2CCC(N(C3CCC(C)CC3)C3CCC(C)CC3)CC2)CC1 |
| InChI | InChI=1S/C32H53NO2/c1-23(2)32(34)35-31-21-13-27(14-22-31)10-9-26-11-19-30(20-12-26)33(28-15-5-24(3)6-16-28)29-17-7-25(4)8-18-29/h9-10,24-31H,1,5-8,11-22H2,2-4H3 |
| InChIKey | AMRNLRXLEGJMIT-UHFFFAOYSA-N |
| XLogP | 8.24 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.78 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|