C49H47N6O5Y- — CID 140571935
[4-[[9-(6-methanidyl-4-tritylmorpholin-2-yl)-2-[(2-phenylacetyl)amino]purin-6-yl]oxymethyl]phenyl] 2,2-dimethylpropanoate;yttrium (PubChem CID 140571935) has the molecular formula C49H47N6O5Y- and a molecular weight of 888.86 g/mol. Its IUPAC name is [4-[[9-(6-methanidyl-4-tritylmorpholin-2-yl)-2-[(2-phenylacetyl)amino]purin-6-yl]oxymethyl]phenyl] 2,2-dimethylpropanoate;yttrium.
| Compound Name | [4-[[9-(6-methanidyl-4-tritylmorpholin-2-yl)-2-[(2-phenylacetyl)amino]purin-6-yl]oxymethyl]phenyl] 2,2-dimethylpropanoate;yttrium |
|---|---|
| PubChem CID | 140571935 |
| Molecular Formula | C49H47N6O5Y- |
| Molecular Weight | 888.86 g/mol |
| Exact Mass | 888.27 |
| IUPAC Name | [4-[[9-(6-methanidyl-4-tritylmorpholin-2-yl)-2-[(2-phenylacetyl)amino]purin-6-yl]oxymethyl]phenyl] 2,2-dimethylpropanoate;yttrium |
| SMILES | [CH2-]C1CN(C(c2ccccc2)(c2ccccc2)c2ccccc2)CC(n2cnc3c(OCc4ccc(OC(=O)C(C)(C)C)cc4)nc(NC(=O)Cc4ccccc4)nc32)O1.[Y] |
| InChI | InChI=1S/C49H47N6O5.Y/c1-34-30-54(49(37-19-11-6-12-20-37,38-21-13-7-14-22-38)39-23-15-8-16-24-39)31-42(59-34)55-33-50-43-44(55)52-47(51-41(56)29-35-17-9-5-10-18-35)53-45(43)58-32-36-25-27-40(28-26-36)60-46(57)48(2,3)4;/h5-28,33-34,42H,1,29-32H2,2-4H3,(H,51,52,53,56);/q-1; |
| InChIKey | ZSDJOKPKODISPZ-UHFFFAOYSA-N |
| XLogP | 8.56 |
| TPSA | 120.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 888.86 |
| LogP ≤ 5 | 8.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|