C21H27FN6O3 — CID 140572175
3-fluoro-1-[4-[[6-(2-methylpropylamino)-3-nitro-2-pyridinyl]amino]phenyl]piperidine-4-carboxamide (PubChem CID 140572175) has the molecular formula C21H27FN6O3 and a molecular weight of 430.48 g/mol. Its IUPAC name is 3-fluoro-1-[4-[[6-(2-methylpropylamino)-3-nitro-2-pyridinyl]amino]phenyl]piperidine-4-carboxamide.
| Compound Name | 3-fluoro-1-[4-[[6-(2-methylpropylamino)-3-nitro-2-pyridinyl]amino]phenyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 140572175 |
| Molecular Formula | C21H27FN6O3 |
| Molecular Weight | 430.48 g/mol |
| Exact Mass | 430.21 |
| IUPAC Name | 3-fluoro-1-[4-[[6-(2-methylpropylamino)-3-nitro-2-pyridinyl]amino]phenyl]piperidine-4-carboxamide |
| SMILES | CC(C)CNc1ccc([N+](=O)[O-])c(Nc2ccc(N3CCC(C(N)=O)C(F)C3)cc2)n1 |
| InChI | InChI=1S/C21H27FN6O3/c1-13(2)11-24-19-8-7-18(28(30)31)21(26-19)25-14-3-5-15(6-4-14)27-10-9-16(20(23)29)17(22)12-27/h3-8,13,16-17H,9-12H2,1-2H3,(H2,23,29)(H2,24,25,26) |
| InChIKey | KGFXIBQNQVOAQN-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 126.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.48 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|