C23H33N3O6 — CID 140576460
(2S)-2-acetyl-1-[(2S)-6-amino-2-[[(1S)-1-carboxy-3-phenylpropyl]amino]hexanoyl]pyrrolidine-2-carboxylic acid (PubChem CID 140576460) has the molecular formula C23H33N3O6 and a molecular weight of 447.53 g/mol. Its IUPAC name is (2S)-2-acetyl-1-[(2S)-6-amino-2-[[(1S)-1-carboxy-3-phenylpropyl]amino]hexanoyl]pyrrolidine-2-carboxylic acid.
| Compound Name | (2S)-2-acetyl-1-[(2S)-6-amino-2-[[(1S)-1-carboxy-3-phenylpropyl]amino]hexanoyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 140576460 |
| Molecular Formula | C23H33N3O6 |
| Molecular Weight | 447.53 g/mol |
| Exact Mass | 447.24 |
| IUPAC Name | (2S)-2-acetyl-1-[(2S)-6-amino-2-[[(1S)-1-carboxy-3-phenylpropyl]amino]hexanoyl]pyrrolidine-2-carboxylic acid |
| SMILES | CC(=O)[C@]1(C(=O)O)CCCN1C(=O)[C@H](CCCCN)N[C@@H](CCc1ccccc1)C(=O)O |
| InChI | InChI=1S/C23H33N3O6/c1-16(27)23(22(31)32)13-7-15-26(23)20(28)18(10-5-6-14-24)25-19(21(29)30)12-11-17-8-3-2-4-9-17/h2-4,8-9,18-19,25H,5-7,10-15,24H2,1H3,(H,29,30)(H,31,32)/t18-,19-,23-/m0/s1 |
| InChIKey | LTPVCWAGYKMQAN-YDHSSHFGSA-N |
| XLogP | 1.19 |
| TPSA | 150.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.53 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|