About diphenylmethanesulfinyl chloride
diphenylmethanesulfinyl chloride (PubChem CID 140576973) has the molecular formula C13H11ClOS
and a molecular weight of 250.75 g/mol. Its IUPAC name is diphenylmethanesulfinyl chloride.
Molecular Properties
| Compound Name | diphenylmethanesulfinyl chloride |
| PubChem CID | 140576973 |
| Molecular Formula | C13H11ClOS |
| Molecular Weight | 250.75 g/mol |
| Exact Mass | 250.02 |
| IUPAC Name | diphenylmethanesulfinyl chloride |
| SMILES | O=S(Cl)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C13H11ClOS/c14-16(15)13(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10,13H |
| InChIKey | HFFSAYQXMCLBGG-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.75 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze diphenylmethanesulfinyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diphenylmethanesulfinyl chloride?
The IUPAC name of diphenylmethanesulfinyl chloride (CID 140576973) is diphenylmethanesulfinyl chloride.
What is the SMILES notation for diphenylmethanesulfinyl chloride?
The canonical SMILES for diphenylmethanesulfinyl chloride is O=S(Cl)C(c1ccccc1)c1ccccc1.
What is the InChIKey of diphenylmethanesulfinyl chloride?
The InChIKey is HFFSAYQXMCLBGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11ClOS/c14-16(15)13(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10,13H.
What are the key properties of diphenylmethanesulfinyl chloride?
diphenylmethanesulfinyl chloride has a molecular weight of 250.75 g/mol, XLogP of 3.68, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for diphenylmethanesulfinyl chloride is sourced from PubChem (CID 140576973), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).