diphenylmethanesulfinyl chloride

C13H11ClOS — CID 140576973

IUPACdiphenylmethanesulfinyl chloride
SMILESO=S(Cl)C(c1ccccc1)c1ccccc1
InChIInChI=1S/C13H11ClOS/c14-16(15)13(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10,13H
InChIKeyHFFSAYQXMCLBGG-UHFFFAOYSA-N
MW250.75 g/mol
LogP3.68
Rot. Bonds3

About diphenylmethanesulfinyl chloride

diphenylmethanesulfinyl chloride (PubChem CID 140576973) has the molecular formula C13H11ClOS and a molecular weight of 250.75 g/mol. Its IUPAC name is diphenylmethanesulfinyl chloride.

Molecular Properties

Compound Namediphenylmethanesulfinyl chloride
PubChem CID140576973
Molecular FormulaC13H11ClOS
Molecular Weight250.75 g/mol
Exact Mass250.02
IUPAC Namediphenylmethanesulfinyl chloride
SMILESO=S(Cl)C(c1ccccc1)c1ccccc1
InChIInChI=1S/C13H11ClOS/c14-16(15)13(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10,13H
InChIKeyHFFSAYQXMCLBGG-UHFFFAOYSA-N
XLogP3.68
TPSA17.07 Ų
H-Bond Donors
H-Bond Acceptors1
Rotatable Bonds3
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500250.75
LogP ≤ 53.68
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 101

Analyze diphenylmethanesulfinyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of diphenylmethanesulfinyl chloride?
The IUPAC name of diphenylmethanesulfinyl chloride (CID 140576973) is diphenylmethanesulfinyl chloride.
What is the SMILES notation for diphenylmethanesulfinyl chloride?
The canonical SMILES for diphenylmethanesulfinyl chloride is O=S(Cl)C(c1ccccc1)c1ccccc1.
What is the InChIKey of diphenylmethanesulfinyl chloride?
The InChIKey is HFFSAYQXMCLBGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11ClOS/c14-16(15)13(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10,13H.
What are the key properties of diphenylmethanesulfinyl chloride?
diphenylmethanesulfinyl chloride has a molecular weight of 250.75 g/mol, XLogP of 3.68, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for diphenylmethanesulfinyl chloride is sourced from PubChem (CID 140576973), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).