About 1,1'-biphenyl;thionyl dichloride
1,1'-biphenyl;thionyl dichloride (PubChem CID 88653349) has the molecular formula C12H10Cl2OS
and a molecular weight of 273.18 g/mol. Its IUPAC name is 1,1'-biphenyl;thionyl dichloride.
Molecular Properties
| Compound Name | 1,1'-biphenyl;thionyl dichloride |
| PubChem CID | 88653349 |
| Molecular Formula | C12H10Cl2OS |
| Molecular Weight | 273.18 g/mol |
| Exact Mass | 271.98 |
| IUPAC Name | 1,1'-biphenyl;thionyl dichloride |
| SMILES | O=S(Cl)Cl.c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C12H10.Cl2OS/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;1-4(2)3/h1-10H; |
| InChIKey | WWDKHALBHMQTJU-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.18 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1,1'-biphenyl;thionyl dichloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1'-biphenyl;thionyl dichloride?
The IUPAC name of 1,1'-biphenyl;thionyl dichloride (CID 88653349) is 1,1'-biphenyl;thionyl dichloride.
What is the SMILES notation for 1,1'-biphenyl;thionyl dichloride?
The canonical SMILES for 1,1'-biphenyl;thionyl dichloride is O=S(Cl)Cl.c1ccc(-c2ccccc2)cc1.
What is the InChIKey of 1,1'-biphenyl;thionyl dichloride?
The InChIKey is WWDKHALBHMQTJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10.Cl2OS/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;1-4(2)3/h1-10H;.
What are the key properties of 1,1'-biphenyl;thionyl dichloride?
1,1'-biphenyl;thionyl dichloride has a molecular weight of 273.18 g/mol, XLogP of 4.40, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1'-biphenyl;thionyl dichloride is sourced from PubChem (CID 88653349), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).