C24H17F6N3O3 — CID 140578766
2-(2-methoxyiminoethyl)-4-[5-(trifluoromethyl)-5-(3,4,5-trifluorophenyl)-4H-1,2-oxazol-3-yl]naphthalene-1-carboxamide (PubChem CID 140578766) has the molecular formula C24H17F6N3O3 and a molecular weight of 509.41 g/mol. Its IUPAC name is 2-(2-methoxyiminoethyl)-4-[5-(trifluoromethyl)-5-(3,4,5-trifluorophenyl)-4H-1,2-oxazol-3-yl]naphthalene-1-carboxamide.
| Compound Name | 2-(2-methoxyiminoethyl)-4-[5-(trifluoromethyl)-5-(3,4,5-trifluorophenyl)-4H-1,2-oxazol-3-yl]naphthalene-1-carboxamide |
|---|---|
| PubChem CID | 140578766 |
| Molecular Formula | C24H17F6N3O3 |
| Molecular Weight | 509.41 g/mol |
| Exact Mass | 509.12 |
| IUPAC Name | 2-(2-methoxyiminoethyl)-4-[5-(trifluoromethyl)-5-(3,4,5-trifluorophenyl)-4H-1,2-oxazol-3-yl]naphthalene-1-carboxamide |
| SMILES | CON=CCc1cc(C2=NOC(c3cc(F)c(F)c(F)c3)(C(F)(F)F)C2)c2ccccc2c1C(N)=O |
| InChI | InChI=1S/C24H17F6N3O3/c1-35-32-7-6-12-8-16(14-4-2-3-5-15(14)20(12)22(31)34)19-11-23(36-33-19,24(28,29)30)13-9-17(25)21(27)18(26)10-13/h2-5,7-10H,6,11H2,1H3,(H2,31,34) |
| InChIKey | CBGWYYZBWNDZMT-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 86.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.41 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|