C25H19F6N3O3 — CID 140578803
2-(2-methoxyiminoethyl)-4-[5-(trifluoromethyl)-5-[3-(trifluoromethyl)phenyl]-4H-1,2-oxazol-3-yl]naphthalene-1-carboxamide (PubChem CID 140578803) has the molecular formula C25H19F6N3O3 and a molecular weight of 523.43 g/mol. Its IUPAC name is 2-(2-methoxyiminoethyl)-4-[5-(trifluoromethyl)-5-[3-(trifluoromethyl)phenyl]-4H-1,2-oxazol-3-yl]naphthalene-1-carboxamide.
| Compound Name | 2-(2-methoxyiminoethyl)-4-[5-(trifluoromethyl)-5-[3-(trifluoromethyl)phenyl]-4H-1,2-oxazol-3-yl]naphthalene-1-carboxamide |
|---|---|
| PubChem CID | 140578803 |
| Molecular Formula | C25H19F6N3O3 |
| Molecular Weight | 523.43 g/mol |
| Exact Mass | 523.13 |
| IUPAC Name | 2-(2-methoxyiminoethyl)-4-[5-(trifluoromethyl)-5-[3-(trifluoromethyl)phenyl]-4H-1,2-oxazol-3-yl]naphthalene-1-carboxamide |
| SMILES | CON=CCc1cc(C2=NOC(c3cccc(C(F)(F)F)c3)(C(F)(F)F)C2)c2ccccc2c1C(N)=O |
| InChI | InChI=1S/C25H19F6N3O3/c1-36-33-10-9-14-11-19(17-7-2-3-8-18(17)21(14)22(32)35)20-13-23(37-34-20,25(29,30)31)15-5-4-6-16(12-15)24(26,27)28/h2-8,10-12H,9,13H2,1H3,(H2,32,35) |
| InChIKey | ZVEWFCCPLFUBQO-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 86.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.43 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|