C32H29N3O6S — CID 140579118
methyl 3-[[4-[4-(butylsulfamoyl)phenyl]benzoyl]amino]-4-(3-cyanophenoxy)benzoate (PubChem CID 140579118) has the molecular formula C32H29N3O6S and a molecular weight of 583.67 g/mol. Its IUPAC name is methyl 3-[[4-[4-(butylsulfamoyl)phenyl]benzoyl]amino]-4-(3-cyanophenoxy)benzoate.
| Compound Name | methyl 3-[[4-[4-(butylsulfamoyl)phenyl]benzoyl]amino]-4-(3-cyanophenoxy)benzoate |
|---|---|
| PubChem CID | 140579118 |
| Molecular Formula | C32H29N3O6S |
| Molecular Weight | 583.67 g/mol |
| Exact Mass | 583.18 |
| IUPAC Name | methyl 3-[[4-[4-(butylsulfamoyl)phenyl]benzoyl]amino]-4-(3-cyanophenoxy)benzoate |
| SMILES | CCCCNS(=O)(=O)c1ccc(-c2ccc(C(=O)Nc3cc(C(=O)OC)ccc3Oc3cccc(C#N)c3)cc2)cc1 |
| InChI | InChI=1S/C32H29N3O6S/c1-3-4-18-34-42(38,39)28-15-12-24(13-16-28)23-8-10-25(11-9-23)31(36)35-29-20-26(32(37)40-2)14-17-30(29)41-27-7-5-6-22(19-27)21-33/h5-17,19-20,34H,3-4,18H2,1-2H3,(H,35,36) |
| InChIKey | LTJXLKOMKCBFGK-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 134.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.67 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|