C17H21NO3 — CID 140579472
7-(8-azabicyclo[3.2.1]octan-3-yloxy)-3-methyl-3,4-dihydrochromen-2-one (PubChem CID 140579472) has the molecular formula C17H21NO3 and a molecular weight of 287.36 g/mol. Its IUPAC name is 7-(8-azabicyclo[3.2.1]octan-3-yloxy)-3-methyl-3,4-dihydrochromen-2-one.
| Compound Name | 7-(8-azabicyclo[3.2.1]octan-3-yloxy)-3-methyl-3,4-dihydrochromen-2-one |
|---|---|
| PubChem CID | 140579472 |
| Molecular Formula | C17H21NO3 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | 7-(8-azabicyclo[3.2.1]octan-3-yloxy)-3-methyl-3,4-dihydrochromen-2-one |
| SMILES | CC1Cc2ccc(OC3CC4CCC(C3)N4)cc2OC1=O |
| InChI | InChI=1S/C17H21NO3/c1-10-6-11-2-5-14(9-16(11)21-17(10)19)20-15-7-12-3-4-13(8-15)18-12/h2,5,9-10,12-13,15,18H,3-4,6-8H2,1H3 |
| InChIKey | QNJUXVLJYNMJHZ-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|