C39H61N3O5+2 — CID 140580929
trimethyl-[2-[2-[2-(3-methyl-N-[2-phenyl-2-[2-[2-[2-(trimethylazaniumyl)ethoxy]ethoxy]ethoxy]ethyl]anilino)-1-phenylethoxy]ethoxy]ethyl]azanium (PubChem CID 140580929) has the molecular formula C39H61N3O5+2 and a molecular weight of 651.93 g/mol. Its IUPAC name is trimethyl-[2-[2-[2-(3-methyl-N-[2-phenyl-2-[2-[2-[2-(trimethylazaniumyl)ethoxy]ethoxy]ethoxy]ethyl]anilino)-1-phenylethoxy]ethoxy]ethyl]azanium.
| Compound Name | trimethyl-[2-[2-[2-(3-methyl-N-[2-phenyl-2-[2-[2-[2-(trimethylazaniumyl)ethoxy]ethoxy]ethoxy]ethyl]anilino)-1-phenylethoxy]ethoxy]ethyl]azanium |
|---|---|
| PubChem CID | 140580929 |
| Molecular Formula | C39H61N3O5+2 |
| Molecular Weight | 651.93 g/mol |
| Exact Mass | 651.46 |
| IUPAC Name | trimethyl-[2-[2-[2-(3-methyl-N-[2-phenyl-2-[2-[2-[2-(trimethylazaniumyl)ethoxy]ethoxy]ethoxy]ethyl]anilino)-1-phenylethoxy]ethoxy]ethyl]azanium |
| SMILES | Cc1cccc(N(CC(OCCOCCOCC[N+](C)(C)C)c2ccccc2)CC(OCCOCC[N+](C)(C)C)c2ccccc2)c1 |
| InChI | InChI=1S/C39H61N3O5/c1-34-15-14-20-37(31-34)40(32-38(35-16-10-8-11-17-35)46-29-27-44-24-22-42(5,6)7)33-39(36-18-12-9-13-19-36)47-30-28-45-26-25-43-23-21-41(2,3)4/h8-20,31,38-39H,21-30,32-33H2,1-7H3/q+2 |
| InChIKey | XWKRXAJSCYNALY-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 49.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.93 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|