C32H39N9O8 — CID 140582565
tert-butyl N-[4-[4-[3,5-bis[[5-[(Z)-N'-hydroxycarbamimidoyl]-2-pyridinyl]oxy]benzoyl]piperazin-1-yl]-4-oxobutyl]carbamate (PubChem CID 140582565) has the molecular formula C32H39N9O8 and a molecular weight of 677.72 g/mol. Its IUPAC name is tert-butyl N-[4-[4-[3,5-bis[[5-[(Z)-N'-hydroxycarbamimidoyl]-2-pyridinyl]oxy]benzoyl]piperazin-1-yl]-4-oxobutyl]carbamate.
| Compound Name | tert-butyl N-[4-[4-[3,5-bis[[5-[(Z)-N'-hydroxycarbamimidoyl]-2-pyridinyl]oxy]benzoyl]piperazin-1-yl]-4-oxobutyl]carbamate |
|---|---|
| PubChem CID | 140582565 |
| Molecular Formula | C32H39N9O8 |
| Molecular Weight | 677.72 g/mol |
| Exact Mass | 677.29 |
| IUPAC Name | tert-butyl N-[4-[4-[3,5-bis[[5-[(Z)-N'-hydroxycarbamimidoyl]-2-pyridinyl]oxy]benzoyl]piperazin-1-yl]-4-oxobutyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCC(=O)N1CCN(C(=O)c2cc(Oc3ccc(/C(N)=N/O)cn3)cc(Oc3ccc(/C(N)=N/O)cn3)c2)CC1 |
| InChI | InChI=1S/C32H39N9O8/c1-32(2,3)49-31(44)35-10-4-5-27(42)40-11-13-41(14-12-40)30(43)22-15-23(47-25-8-6-20(18-36-25)28(33)38-45)17-24(16-22)48-26-9-7-21(19-37-26)29(34)39-46/h6-9,15-19,45-46H,4-5,10-14H2,1-3H3,(H2,33,38)(H2,34,39)(H,35,44) |
| InChIKey | YTZGBBDXPWTWRJ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 240.41 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.72 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|