C16H18N2O4S — CID 140582609
N-[(1S)-1-(4-hydroxy-3-methylsulfonylphenyl)propyl]pyridine-4-carboxamide (PubChem CID 140582609) has the molecular formula C16H18N2O4S and a molecular weight of 334.40 g/mol. Its IUPAC name is N-[(1S)-1-(4-hydroxy-3-methylsulfonylphenyl)propyl]pyridine-4-carboxamide.
| Compound Name | N-[(1S)-1-(4-hydroxy-3-methylsulfonylphenyl)propyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 140582609 |
| Molecular Formula | C16H18N2O4S |
| Molecular Weight | 334.40 g/mol |
| Exact Mass | 334.10 |
| IUPAC Name | N-[(1S)-1-(4-hydroxy-3-methylsulfonylphenyl)propyl]pyridine-4-carboxamide |
| SMILES | CC[C@H](NC(=O)c1ccncc1)c1ccc(O)c(S(C)(=O)=O)c1 |
| InChI | InChI=1S/C16H18N2O4S/c1-3-13(18-16(20)11-6-8-17-9-7-11)12-4-5-14(19)15(10-12)23(2,21)22/h4-10,13,19H,3H2,1-2H3,(H,18,20)/t13-/m0/s1 |
| InChIKey | UOZJWVMYPKFEPX-ZDUSSCGKSA-N |
| XLogP | 2.07 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.40 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |