C15H18N4O3S — CID 140582708
N-[(1S)-3-amino-1-(2-methylsulfonyl-4-pyridinyl)propyl]pyridine-4-carboxamide (PubChem CID 140582708) has the molecular formula C15H18N4O3S and a molecular weight of 334.40 g/mol. Its IUPAC name is N-[(1S)-3-amino-1-(2-methylsulfonyl-4-pyridinyl)propyl]pyridine-4-carboxamide.
| Compound Name | N-[(1S)-3-amino-1-(2-methylsulfonyl-4-pyridinyl)propyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 140582708 |
| Molecular Formula | C15H18N4O3S |
| Molecular Weight | 334.40 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | N-[(1S)-3-amino-1-(2-methylsulfonyl-4-pyridinyl)propyl]pyridine-4-carboxamide |
| SMILES | CS(=O)(=O)c1cc([C@H](CCN)NC(=O)c2ccncc2)ccn1 |
| InChI | InChI=1S/C15H18N4O3S/c1-23(21,22)14-10-12(5-9-18-14)13(2-6-16)19-15(20)11-3-7-17-8-4-11/h3-5,7-10,13H,2,6,16H2,1H3,(H,19,20)/t13-/m0/s1 |
| InChIKey | UPTSFPXTPPMXBH-ZDUSSCGKSA-N |
| XLogP | 0.70 |
| TPSA | 115.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.40 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |