C15H16N4O4S — CID 140582644
N-[(1S)-3-amino-1-(2-methylsulfonyl-4-pyridinyl)-3-oxopropyl]pyridine-4-carboxamide (PubChem CID 140582644) has the molecular formula C15H16N4O4S and a molecular weight of 348.38 g/mol. Its IUPAC name is N-[(1S)-3-amino-1-(2-methylsulfonyl-4-pyridinyl)-3-oxopropyl]pyridine-4-carboxamide.
| Compound Name | N-[(1S)-3-amino-1-(2-methylsulfonyl-4-pyridinyl)-3-oxopropyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 140582644 |
| Molecular Formula | C15H16N4O4S |
| Molecular Weight | 348.38 g/mol |
| Exact Mass | 348.09 |
| IUPAC Name | N-[(1S)-3-amino-1-(2-methylsulfonyl-4-pyridinyl)-3-oxopropyl]pyridine-4-carboxamide |
| SMILES | CS(=O)(=O)c1cc([C@H](CC(N)=O)NC(=O)c2ccncc2)ccn1 |
| InChI | InChI=1S/C15H16N4O4S/c1-24(22,23)14-8-11(4-7-18-14)12(9-13(16)20)19-15(21)10-2-5-17-6-3-10/h2-8,12H,9H2,1H3,(H2,16,20)(H,19,21)/t12-/m0/s1 |
| InChIKey | KGVORZQSXAXHGQ-LBPRGKRZSA-N |
| XLogP | 0.23 |
| TPSA | 132.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.38 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |