C12H13F2N3O2 — CID 140585760
(3R)-5-azido-4,4-difluoro-3-phenylmethoxypent-1-en-2-ol (PubChem CID 140585760) has the molecular formula C12H13F2N3O2 and a molecular weight of 269.25 g/mol. Its IUPAC name is (3R)-5-azido-4,4-difluoro-3-phenylmethoxypent-1-en-2-ol.
| Compound Name | (3R)-5-azido-4,4-difluoro-3-phenylmethoxypent-1-en-2-ol |
|---|---|
| PubChem CID | 140585760 |
| Molecular Formula | C12H13F2N3O2 |
| Molecular Weight | 269.25 g/mol |
| Exact Mass | 269.10 |
| IUPAC Name | (3R)-5-azido-4,4-difluoro-3-phenylmethoxypent-1-en-2-ol |
| SMILES | C=C(O)[C@@H](OCc1ccccc1)C(F)(F)CN=[N+]=[N-] |
| InChI | InChI=1S/C12H13F2N3O2/c1-9(18)11(12(13,14)8-16-17-15)19-7-10-5-3-2-4-6-10/h2-6,11,18H,1,7-8H2/t11-/m1/s1 |
| InChIKey | STIAQIDTERYMRV-LLVKDONJSA-N |
| XLogP | 3.59 |
| TPSA | 78.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.25 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|