C18H16N3O7S2- — CID 140586500
7-methoxycarbonyl-8-(4-methylphenyl)sulfonyloxy-5-[methyl(sulfinato)amino]-1,6-naphthyridine (PubChem CID 140586500) has the molecular formula C18H16N3O7S2- and a molecular weight of 450.47 g/mol. Its IUPAC name is 7-methoxycarbonyl-8-(4-methylphenyl)sulfonyloxy-5-[methyl(sulfinato)amino]-1,6-naphthyridine.
| Compound Name | 7-methoxycarbonyl-8-(4-methylphenyl)sulfonyloxy-5-[methyl(sulfinato)amino]-1,6-naphthyridine |
|---|---|
| PubChem CID | 140586500 |
| Molecular Formula | C18H16N3O7S2- |
| Molecular Weight | 450.47 g/mol |
| Exact Mass | 450.04 |
| IUPAC Name | 7-methoxycarbonyl-8-(4-methylphenyl)sulfonyloxy-5-[methyl(sulfinato)amino]-1,6-naphthyridine |
| SMILES | COC(=O)c1nc(N(C)S(=O)[O-])c2cccnc2c1OS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C18H17N3O7S2/c1-11-6-8-12(9-7-11)30(25,26)28-16-14-13(5-4-10-19-14)17(21(2)29(23)24)20-15(16)18(22)27-3/h4-10H,1-3H3,(H,23,24)/p-1 |
| InChIKey | YOLAZJBDSLNDQJ-UHFFFAOYSA-M |
| XLogP | 1.72 |
| TPSA | 138.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.47 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|