C36H46Si — CID 140588355
(3-tert-butylcyclopenta-1,3-dien-1-yl)-tris(3-propan-2-ylphenyl)silane (PubChem CID 140588355) has the molecular formula C36H46Si and a molecular weight of 506.85 g/mol. Its IUPAC name is (3-tert-butylcyclopenta-1,3-dien-1-yl)-tris(3-propan-2-ylphenyl)silane.
| Compound Name | (3-tert-butylcyclopenta-1,3-dien-1-yl)-tris(3-propan-2-ylphenyl)silane |
|---|---|
| PubChem CID | 140588355 |
| Molecular Formula | C36H46Si |
| Molecular Weight | 506.85 g/mol |
| Exact Mass | 506.34 |
| IUPAC Name | (3-tert-butylcyclopenta-1,3-dien-1-yl)-tris(3-propan-2-ylphenyl)silane |
| SMILES | CC(C)c1cccc([Si](C2=CC(C(C)(C)C)=CC2)(c2cccc(C(C)C)c2)c2cccc(C(C)C)c2)c1 |
| InChI | InChI=1S/C36H46Si/c1-25(2)28-13-10-16-32(21-28)37(33-17-11-14-29(22-33)26(3)4,34-18-12-15-30(23-34)27(5)6)35-20-19-31(24-35)36(7,8)9/h10-19,21-27H,20H2,1-9H3 |
| InChIKey | KWLNDAWUHOGZDD-UHFFFAOYSA-N |
| XLogP | 8.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.85 |
| LogP ≤ 5 | 8.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|