C33H40Si — CID 140671836
(3-methylcyclopenta-1,3-dien-1-yl)-tris(3-propan-2-ylphenyl)silane (PubChem CID 140671836) has the molecular formula C33H40Si and a molecular weight of 464.77 g/mol. Its IUPAC name is (3-methylcyclopenta-1,3-dien-1-yl)-tris(3-propan-2-ylphenyl)silane.
| Compound Name | (3-methylcyclopenta-1,3-dien-1-yl)-tris(3-propan-2-ylphenyl)silane |
|---|---|
| PubChem CID | 140671836 |
| Molecular Formula | C33H40Si |
| Molecular Weight | 464.77 g/mol |
| Exact Mass | 464.29 |
| IUPAC Name | (3-methylcyclopenta-1,3-dien-1-yl)-tris(3-propan-2-ylphenyl)silane |
| SMILES | CC1=CCC([Si](c2cccc(C(C)C)c2)(c2cccc(C(C)C)c2)c2cccc(C(C)C)c2)=C1 |
| InChI | InChI=1S/C33H40Si/c1-23(2)27-11-8-14-30(20-27)34(33-18-17-26(7)19-33,31-15-9-12-28(21-31)24(3)4)32-16-10-13-29(22-32)25(5)6/h8-17,19-25H,18H2,1-7H3 |
| InChIKey | JFQREPGXRPEJGX-UHFFFAOYSA-N |
| XLogP | 7.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.77 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|