C39H44Si — CID 140589112
(3-benzylcyclopenta-1,3-dien-1-yl)-tris(3-propan-2-ylphenyl)silane (PubChem CID 140589112) has the molecular formula C39H44Si and a molecular weight of 540.87 g/mol. Its IUPAC name is (3-benzylcyclopenta-1,3-dien-1-yl)-tris(3-propan-2-ylphenyl)silane.
| Compound Name | (3-benzylcyclopenta-1,3-dien-1-yl)-tris(3-propan-2-ylphenyl)silane |
|---|---|
| PubChem CID | 140589112 |
| Molecular Formula | C39H44Si |
| Molecular Weight | 540.87 g/mol |
| Exact Mass | 540.32 |
| IUPAC Name | (3-benzylcyclopenta-1,3-dien-1-yl)-tris(3-propan-2-ylphenyl)silane |
| SMILES | CC(C)c1cccc([Si](C2=CC(Cc3ccccc3)=CC2)(c2cccc(C(C)C)c2)c2cccc(C(C)C)c2)c1 |
| InChI | InChI=1S/C39H44Si/c1-28(2)33-15-10-18-36(25-33)40(37-19-11-16-34(26-37)29(3)4,38-20-12-17-35(27-38)30(5)6)39-22-21-32(24-39)23-31-13-8-7-9-14-31/h7-21,24-30H,22-23H2,1-6H3 |
| InChIKey | RSVJRGNASMWKOI-UHFFFAOYSA-N |
| XLogP | 8.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.87 |
| LogP ≤ 5 | 8.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|