C18H28 — CID 140596669
1-but-3-enyl-2,3-dibutylbenzene (PubChem CID 140596669) has the molecular formula C18H28 and a molecular weight of 244.42 g/mol. Its IUPAC name is 1-but-3-enyl-2,3-dibutylbenzene.
| Compound Name | 1-but-3-enyl-2,3-dibutylbenzene |
|---|---|
| PubChem CID | 140596669 |
| Molecular Formula | C18H28 |
| Molecular Weight | 244.42 g/mol |
| Exact Mass | 244.22 |
| IUPAC Name | 1-but-3-enyl-2,3-dibutylbenzene |
| SMILES | C=CCCc1cccc(CCCC)c1CCCC |
| InChI | InChI=1S/C18H28/c1-4-7-11-16-13-10-14-17(12-8-5-2)18(16)15-9-6-3/h4,10,13-14H,1,5-9,11-12,15H2,2-3H3 |
| InChIKey | ZAEOBDDSJOGJHT-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.42 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|