About chlorocopper;2-ethyl-6-naphthalen-2-ylpyridine
chlorocopper;2-ethyl-6-naphthalen-2-ylpyridine (PubChem CID 140599662) has the molecular formula C17H15ClCuN
and a molecular weight of 332.31 g/mol. Its IUPAC name is chlorocopper;2-ethyl-6-naphthalen-2-ylpyridine.
Molecular Properties
| Compound Name | chlorocopper;2-ethyl-6-naphthalen-2-ylpyridine |
| PubChem CID | 140599662 |
| Molecular Formula | C17H15ClCuN |
| Molecular Weight | 332.31 g/mol |
| Exact Mass | 331.02 |
| IUPAC Name | chlorocopper;2-ethyl-6-naphthalen-2-ylpyridine |
| SMILES | CCc1cccc(-c2ccc3ccccc3c2)n1.Cl[Cu] |
| InChI | InChI=1S/C17H15N.ClH.Cu/c1-2-16-8-5-9-17(18-16)15-11-10-13-6-3-4-7-14(13)12-15;;/h3-12H,2H2,1H3;1H;/q;;+1/p-1 |
| InChIKey | CWINJDAIQPFIIO-UHFFFAOYSA-M |
| XLogP | 5.15 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 332.31 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze chlorocopper;2-ethyl-6-naphthalen-2-ylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chlorocopper;2-ethyl-6-naphthalen-2-ylpyridine?
The IUPAC name of chlorocopper;2-ethyl-6-naphthalen-2-ylpyridine (CID 140599662) is chlorocopper;2-ethyl-6-naphthalen-2-ylpyridine.
What is the SMILES notation for chlorocopper;2-ethyl-6-naphthalen-2-ylpyridine?
The canonical SMILES for chlorocopper;2-ethyl-6-naphthalen-2-ylpyridine is CCc1cccc(-c2ccc3ccccc3c2)n1.Cl[Cu].
What is the InChIKey of chlorocopper;2-ethyl-6-naphthalen-2-ylpyridine?
The InChIKey is CWINJDAIQPFIIO-UHFFFAOYSA-M. The full InChI is InChI=1S/C17H15N.ClH.Cu/c1-2-16-8-5-9-17(18-16)15-11-10-13-6-3-4-7-14(13)12-15;;/h3-12H,2H2,1H3;1H;/q;;+1/p-1.
What are the key properties of chlorocopper;2-ethyl-6-naphthalen-2-ylpyridine?
chlorocopper;2-ethyl-6-naphthalen-2-ylpyridine has a molecular weight of 332.31 g/mol, XLogP of 5.15, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for chlorocopper;2-ethyl-6-naphthalen-2-ylpyridine is sourced from PubChem (CID 140599662), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).