C49H29Li2N3O2S+2 — CID 140600460
dilithium;5-[4-[4-(1,3-benzothiazol-2-yl)phenyl]-12-(8-oxidoquinolin-1-ium-5-yl)benzo[a]anthracen-7-yl]quinolin-1-ium-8-olate (PubChem CID 140600460) has the molecular formula C49H29Li2N3O2S+2 and a molecular weight of 737.74 g/mol. Its IUPAC name is dilithium;5-[4-[4-(1,3-benzothiazol-2-yl)phenyl]-12-(8-oxidoquinolin-1-ium-5-yl)benzo[a]anthracen-7-yl]quinolin-1-ium-8-olate.
| Compound Name | dilithium;5-[4-[4-(1,3-benzothiazol-2-yl)phenyl]-12-(8-oxidoquinolin-1-ium-5-yl)benzo[a]anthracen-7-yl]quinolin-1-ium-8-olate |
|---|---|
| PubChem CID | 140600460 |
| Molecular Formula | C49H29Li2N3O2S+2 |
| Molecular Weight | 737.74 g/mol |
| Exact Mass | 737.23 |
| IUPAC Name | dilithium;5-[4-[4-(1,3-benzothiazol-2-yl)phenyl]-12-(8-oxidoquinolin-1-ium-5-yl)benzo[a]anthracen-7-yl]quinolin-1-ium-8-olate |
| SMILES | [Li+].[Li+].[O-]c1ccc(-c2c3ccccc3c(-c3ccc([O-])c4[nH+]cccc34)c3c2ccc2c(-c4ccc(-c5nc6ccccc6s5)cc4)cccc23)c2ccc[nH+]c12 |
| InChI | InChI=1S/C49H29N3O2S.2Li/c53-41-24-22-35(37-12-6-26-50-47(37)41)44-33-8-1-2-9-34(33)45(36-23-25-42(54)48-38(36)13-7-27-51-48)46-32-11-5-10-30(31(32)20-21-39(44)46)28-16-18-29(19-17-28)49-52-40-14-3-4-15-43(40)55-49;;/h1-27,53-54H;;/q;2*+1 |
| InChIKey | LBLVMMUDVCNSIB-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 87.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 57 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 737.74 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|