C40H29AlN2O3S — CID 59318903
bis[(2-methylquinolin-8-yl)oxy]-[4-(5-naphthalen-2-ylthiophen-2-yl)phenoxy]alumane (PubChem CID 59318903) has the molecular formula C40H29AlN2O3S and a molecular weight of 644.73 g/mol. Its IUPAC name is bis[(2-methylquinolin-8-yl)oxy]-[4-(5-naphthalen-2-ylthiophen-2-yl)phenoxy]alumane.
| Compound Name | bis[(2-methylquinolin-8-yl)oxy]-[4-(5-naphthalen-2-ylthiophen-2-yl)phenoxy]alumane |
|---|---|
| PubChem CID | 59318903 |
| Molecular Formula | C40H29AlN2O3S |
| Molecular Weight | 644.73 g/mol |
| Exact Mass | 644.17 |
| IUPAC Name | bis[(2-methylquinolin-8-yl)oxy]-[4-(5-naphthalen-2-ylthiophen-2-yl)phenoxy]alumane |
| SMILES | Cc1ccc2cccc(O[Al](Oc3ccc(-c4ccc(-c5ccc6ccccc6c5)s4)cc3)Oc3cccc4ccc(C)nc34)c2n1 |
| InChI | InChI=1S/C20H14OS.2C10H9NO.Al/c21-18-9-7-15(8-10-18)19-11-12-20(22-19)17-6-5-14-3-1-2-4-16(14)13-17;2*1-7-5-6-8-3-2-4-9(12)10(8)11-7;/h1-13,21H;2*2-6,12H,1H3;/q;;;+3/p-3 |
| InChIKey | NUBPJBXVONFHLH-UHFFFAOYSA-K |
| XLogP | 10.47 |
| TPSA | 53.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.73 |
| LogP ≤ 5 | 10.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |