C46H29LiN3O+ — CID 140600467
lithium 5-[4-[4-(1-phenylbenzimidazol-2-yl)phenyl]benzo[a]anthracen-7-yl]quinolin-1-ium-8-olate (PubChem CID 140600467) has the molecular formula C46H29LiN3O+ and a molecular weight of 646.70 g/mol. Its IUPAC name is lithium 5-[4-[4-(1-phenylbenzimidazol-2-yl)phenyl]benzo[a]anthracen-7-yl]quinolin-1-ium-8-olate.
| Compound Name | lithium 5-[4-[4-(1-phenylbenzimidazol-2-yl)phenyl]benzo[a]anthracen-7-yl]quinolin-1-ium-8-olate |
|---|---|
| PubChem CID | 140600467 |
| Molecular Formula | C46H29LiN3O+ |
| Molecular Weight | 646.70 g/mol |
| Exact Mass | 646.25 |
| IUPAC Name | lithium 5-[4-[4-(1-phenylbenzimidazol-2-yl)phenyl]benzo[a]anthracen-7-yl]quinolin-1-ium-8-olate |
| SMILES | [Li+].[O-]c1ccc(-c2c3ccccc3cc3c2ccc2c(-c4ccc(-c5nc6ccccc6n5-c5ccccc5)cc4)cccc23)c2ccc[nH+]c12 |
| InChI | InChI=1S/C46H29N3O.Li/c50-43-26-25-37(39-16-9-27-47-45(39)43)44-34-13-5-4-10-31(34)28-40-35-15-8-14-33(36(35)23-24-38(40)44)29-19-21-30(22-20-29)46-48-41-17-6-7-18-42(41)49(46)32-11-2-1-3-12-32;/h1-28,50H;/q;+1 |
| InChIKey | CTCNSFQYTOKVBB-UHFFFAOYSA-N |
| XLogP | 7.53 |
| TPSA | 55.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.70 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|