C39H25LiN3O+ — CID 140600478
lithium 5-[3-(2,6-diphenylpyrimidin-4-yl)anthracen-9-yl]quinolin-1-ium-8-olate (PubChem CID 140600478) has the molecular formula C39H25LiN3O+ and a molecular weight of 558.59 g/mol. Its IUPAC name is lithium 5-[3-(2,6-diphenylpyrimidin-4-yl)anthracen-9-yl]quinolin-1-ium-8-olate.
| Compound Name | lithium 5-[3-(2,6-diphenylpyrimidin-4-yl)anthracen-9-yl]quinolin-1-ium-8-olate |
|---|---|
| PubChem CID | 140600478 |
| Molecular Formula | C39H25LiN3O+ |
| Molecular Weight | 558.59 g/mol |
| Exact Mass | 558.22 |
| IUPAC Name | lithium 5-[3-(2,6-diphenylpyrimidin-4-yl)anthracen-9-yl]quinolin-1-ium-8-olate |
| SMILES | [Li+].[O-]c1ccc(-c2c3ccccc3cc3cc(-c4cc(-c5ccccc5)nc(-c5ccccc5)n4)ccc23)c2ccc[nH+]c12 |
| InChI | InChI=1S/C39H25N3O.Li/c43-36-20-19-32(33-16-9-21-40-38(33)36)37-30-15-8-7-14-27(30)22-29-23-28(17-18-31(29)37)35-24-34(25-10-3-1-4-11-25)41-39(42-35)26-12-5-2-6-13-26;/h1-24,43H;/q;+1 |
| InChIKey | VIAKUDSQAKPDOQ-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 62.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.59 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|