C51H32Li2N4O2+2 — CID 140600576
dilithium;7-[10-(8-oxidoquinolin-1-ium-5-yl)-2-[4-(1-phenylbenzimidazol-2-yl)phenyl]anthracen-9-yl]quinolin-1-ium-8-olate (PubChem CID 140600576) has the molecular formula C51H32Li2N4O2+2 and a molecular weight of 746.73 g/mol. Its IUPAC name is dilithium;7-[10-(8-oxidoquinolin-1-ium-5-yl)-2-[4-(1-phenylbenzimidazol-2-yl)phenyl]anthracen-9-yl]quinolin-1-ium-8-olate.
| Compound Name | dilithium;7-[10-(8-oxidoquinolin-1-ium-5-yl)-2-[4-(1-phenylbenzimidazol-2-yl)phenyl]anthracen-9-yl]quinolin-1-ium-8-olate |
|---|---|
| PubChem CID | 140600576 |
| Molecular Formula | C51H32Li2N4O2+2 |
| Molecular Weight | 746.73 g/mol |
| Exact Mass | 746.28 |
| IUPAC Name | dilithium;7-[10-(8-oxidoquinolin-1-ium-5-yl)-2-[4-(1-phenylbenzimidazol-2-yl)phenyl]anthracen-9-yl]quinolin-1-ium-8-olate |
| SMILES | [Li+].[Li+].[O-]c1c(-c2c3ccccc3c(-c3ccc([O-])c4[nH+]cccc34)c3ccc(-c4ccc(-c5nc6ccccc6n5-c5ccccc5)cc4)cc23)ccc2ccc[nH+]c12 |
| InChI | InChI=1S/C51H32N4O2.2Li/c56-45-27-26-38(40-15-9-29-53-49(40)45)46-36-13-4-5-14-37(36)47(41-25-22-32-10-8-28-52-48(32)50(41)57)42-30-34(23-24-39(42)46)31-18-20-33(21-19-31)51-54-43-16-6-7-17-44(43)55(51)35-11-2-1-3-12-35;;/h1-30,56-57H;;/q;2*+1 |
| InChIKey | GAFZKDIQHNLINU-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 92.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 59 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 746.73 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|