C26H20FN5O2 — CID 91564733
3-[(4-fluorophenyl)methyl]-5-(1H-imidazo[4,5-b]pyridin-2-ylmethyl)-7-methylpyrrolo[3,4-g]quinoline-8,9-diol (PubChem CID 91564733) has the molecular formula C26H20FN5O2 and a molecular weight of 453.48 g/mol. Its IUPAC name is 3-[(4-fluorophenyl)methyl]-5-(1H-imidazo[4,5-b]pyridin-2-ylmethyl)-7-methylpyrrolo[3,4-g]quinoline-8,9-diol.
| Compound Name | 3-[(4-fluorophenyl)methyl]-5-(1H-imidazo[4,5-b]pyridin-2-ylmethyl)-7-methylpyrrolo[3,4-g]quinoline-8,9-diol |
|---|---|
| PubChem CID | 91564733 |
| Molecular Formula | C26H20FN5O2 |
| Molecular Weight | 453.48 g/mol |
| Exact Mass | 453.16 |
| IUPAC Name | 3-[(4-fluorophenyl)methyl]-5-(1H-imidazo[4,5-b]pyridin-2-ylmethyl)-7-methylpyrrolo[3,4-g]quinoline-8,9-diol |
| SMILES | Cn1cc2c(Cc3nc4ncccc4[nH]3)c3cc(Cc4ccc(F)cc4)cnc3c(O)c2c1O |
| InChI | InChI=1S/C26H20FN5O2/c1-32-13-19-17(11-21-30-20-3-2-8-28-25(20)31-21)18-10-15(9-14-4-6-16(27)7-5-14)12-29-23(18)24(33)22(19)26(32)34/h2-8,10,12-13,33-34H,9,11H2,1H3,(H,28,30,31) |
| InChIKey | FRFBTZPSIITRAX-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 99.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.48 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|