C28H41NO8 — CID 14060205
[14-acetyloxy-4-ethyl-12,16-dimethoxy-10-(methoxymethyl)-6-oxa-4-azaheptacyclo[15.2.1.02,7.02,11.03,13.05,10.014,19]icosan-18-yl] acetate (PubChem CID 14060205) has the molecular formula C28H41NO8 and a molecular weight of 519.64 g/mol. Its IUPAC name is [14-acetyloxy-4-ethyl-12,16-dimethoxy-10-(methoxymethyl)-6-oxa-4-azaheptacyclo[15.2.1.02,7.02,11.03,13.05,10.014,19]icosan-18-yl] acetate.
| Compound Name | [14-acetyloxy-4-ethyl-12,16-dimethoxy-10-(methoxymethyl)-6-oxa-4-azaheptacyclo[15.2.1.02,7.02,11.03,13.05,10.014,19]icosan-18-yl] acetate |
|---|---|
| PubChem CID | 14060205 |
| Molecular Formula | C28H41NO8 |
| Molecular Weight | 519.64 g/mol |
| Exact Mass | 519.28 |
| IUPAC Name | [14-acetyloxy-4-ethyl-12,16-dimethoxy-10-(methoxymethyl)-6-oxa-4-azaheptacyclo[15.2.1.02,7.02,11.03,13.05,10.014,19]icosan-18-yl] acetate |
| SMILES | CCN1C2OC3CCC2(COC)C2C(OC)C4C1C32C1CC2C(OC)CC4(OC(C)=O)C1C2OC(C)=O |
| InChI | InChI=1S/C28H41NO8/c1-7-29-24-20-22(34-6)23-26(12-32-4)9-8-18(36-25(26)29)28(23,24)16-10-15-17(33-5)11-27(20,37-14(3)31)19(16)21(15)35-13(2)30/h15-25H,7-12H2,1-6H3 |
| InChIKey | YOLDVCPUXVPTOM-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 92.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.64 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |