C30H45NO9 — CID 98105587
[(1S,2R,3R,4S,5R,6S,8R,9R,10S,13S,16S,17R,18R)-4,8-diacetyloxy-11-ethyl-6,18-dimethoxy-13-(methoxymethyl)-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecan-16-yl] acetate (PubChem CID 98105587) has the molecular formula C30H45NO9 and a molecular weight of 563.69 g/mol. Its IUPAC name is [(1S,2R,3R,4S,5R,6S,8R,9R,10S,13S,16S,17R,18R)-4,8-diacetyloxy-11-ethyl-6,18-dimethoxy-13-(methoxymethyl)-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecan-16-yl] acetate.
| Compound Name | [(1S,2R,3R,4S,5R,6S,8R,9R,10S,13S,16S,17R,18R)-4,8-diacetyloxy-11-ethyl-6,18-dimethoxy-13-(methoxymethyl)-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecan-16-yl] acetate |
|---|---|
| PubChem CID | 98105587 |
| Molecular Formula | C30H45NO9 |
| Molecular Weight | 563.69 g/mol |
| Exact Mass | 563.31 |
| IUPAC Name | [(1S,2R,3R,4S,5R,6S,8R,9R,10S,13S,16S,17R,18R)-4,8-diacetyloxy-11-ethyl-6,18-dimethoxy-13-(methoxymethyl)-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecan-16-yl] acetate |
| SMILES | CCN1C[C@]2(COC)CC[C@H](OC(C)=O)[C@@]34[C@@H]5C[C@H]6[C@H](OC(C)=O)[C@@H]5[C@](OC(C)=O)(C[C@@H]6OC)[C@@H]([C@H](OC)[C@H]23)[C@H]14 |
| InChI | InChI=1S/C30H45NO9/c1-8-31-13-28(14-35-5)10-9-21(38-15(2)32)30-19-11-18-20(36-6)12-29(40-17(4)34,22(19)24(18)39-16(3)33)23(27(30)31)25(37-7)26(28)30/h18-27H,8-14H2,1-7H3/t18-,19-,20+,21+,22-,23+,24+,25+,26-,27+,28+,29-,30+/m1/s1 |
| InChIKey | TWHJAEKWJMCVDA-NUYDIMPFSA-N |
| XLogP | 2.21 |
| TPSA | 109.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.69 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|